Source code for modifinder.classes.Compound



import modifinder.utilities.general_utils as general_utils
from modifinder.utilities.mol_utils import _get_molecule
import rdkit.Chem.rdMolDescriptors as rdMolDescriptors
from rdkit import Chem
import numpy as np
import math
import uuid

# import modifinder as mf
from modifinder.classes.Spectrum import Spectrum
from modifinder.classes.StructureMeta import StructureMeta
from .. import convert


[docs]class Compound: """ A class to represent a compound The compound always has spectrum data. If the compound structure is known, it also has a structure property. Attributes ---------- id (str) : The id of the compound spectrum (Spectrum) : Spectrum Tuple representing mz, intensity, Precursor mass and Charge for mass spectrumetry data structure (Chem.Mol): The structure of the compound is_known (bool): A boolean indicating whether the compound is known, derived from the structure usi (str): The USI of the compound name (str): The name of the compound accession (str): The accession of the compound library_membership (str): The GNPS library membership of the compound Examples -------- Create a compound by providing the necessary information: >>> compound = Compound(id="CCMSLIB00005435812", peaks=[[110.066925,38499.089844],[138.060638,412152.093750],[195.079575,6894530.000000],[195.200180,480874.812500],[196.082092,43027.628906]], precursor_mz=195.087, precursor_charge=1, adduct="[M+H]+", smiles="CN1C=NC2=C1C(=O)N(C(=O)N2C)C") Alternatively, you can create a compound by providing a dictionary of data: >>> data = { ... "id": "CCMSLIB00005435812", ... "peaks": [[110.066925,38499.089844],[138.060638,412152.093750],[195.079575,6894530.000000],[195.200180,480874.812500],[196.082092,43027.628906]], ... "precursor_mz": 195.087, ... "charge": 1, ... "adduct": "[M+H]+", ... "smiles": "CN1C=NC2=C1C(=O)N(C(=O)N2C)C" ... } >>> compound = Compound(data) You can also create a compound by providing a usi: >>> usi = "mzspec:GNPS:GNPS-LIBRARY:accession:CCMSLIB00005435812" >>> compound = Compound(usi) or with an accession: >>> accession = "CCMSLIB00005435812" >>> compound = Compound(accession) """
[docs] def __init__(self, incoming_data=None, **kwargs): """Initialize the Compound class The compound class can be initialized in three different ways: 1. By providing a dictionary of data to the *data* parameter that contains all the necessary information 2. By providing a usi to the *data* parameter to retrieve the necessary information from GNPS 3. By providing the necessary information as parameter If both the *data* and the parameters are provided, the parameters will override the data. If of the incoming data and kwargs are provided, an empty instance of the class will be created. Parameters ---------- incoming_data : input data (optional, default: None) The data to initialize the class with, can be a dictionary of data, a usi, or a compound object. If not provided, the class will be initialized with the provided keyword arguments. If provided, the keyword arguments will still override the data. kwargs : keyword arguments (optional, default: No attributes) Attributes to initialize the class with, if provided, they will override the attributes from the data See Also -------- modifinder.convert Spectrum """ # define the attributes of the class self._structure = None self.id = None self._spectrum = None self.usi = None self.is_known = None self.name = None self._distances = None self.additional_attributes = {} self._exact_mass = None if incoming_data is None and len(kwargs) == 0: return # attempt to initialize the class with the provided data if incoming_data is not None: convert.to_compound(incoming_data, use_object = self, **kwargs) else: self.update(**kwargs)
# TODO: write setters for spectrum, structure to warn the user to update the dependent attributes @property def structure(self): return self._structure @structure.setter def structure(self, value): self._structure = value # Automatically update the related attributes if self._structure is not None: self._exact_mass = rdMolDescriptors.CalcExactMolWt(self._structure) self._distances = Chem.rdmolops.GetDistanceMatrix(self._structure) if self.is_known is None and self._structure is not None: self.is_known = True if self.is_known and self._structure is None: self.is_known = None @property def spectrum(self): return self._spectrum @spectrum.setter def spectrum(self, value): self._spectrum = value @property def distances(self) -> dict: """Get the distances between every pair of atoms in the compound Returns ------- dict: A dictionary of distances between every pair of atoms in the compound """ return self._distances @property def exact_mass(self) -> float: """Get the exact mass of the compound Returns ------- float: The exact mass of the compound """ return self._exact_mass
[docs] def clear(self): """Clear the compound data and reset all the attributes to None""" self.structure = None self.id = None self.spectrum = None self.usi = None self.is_known = None self.name = None self._distances = None self.additional_attributes = {} self._exact_mass = None
[docs] def update(self, _structure = None, structure = None, id: str = None, _spectrum: Spectrum = None, spectrum: Spectrum = None, usi: str = None, is_known: bool = None, name: str = None, additional_attributes: dict = {}, **kwargs): """Update the attributes of the class Parameters ---------- _structure (Chem.Mol): The structure of the compound structure (Chem.Mol, Smiles, InChi): The structure of the compound id (str): The id of the compound _spectrum (Spectrum): an instance of Spectrum containing peak information [(mz, intensity)], precursor mass, charge, and adduct for mass spectrumetry data spectrum (Spectrum): an instance of Spectrum containing peak information [(mz, intensity)], precursor mass, charge, and adduct for mass spectrumetry data usi (str): The USI of the compound is_known (bool): A boolean indicating whether the compound is known, if set to False, annotators or other parts of the code will treat this compound as unknown, if not provided but the structure is provided, it will be set to True name (str): The name of the compound distances (dict): A dictionary of distances between every pair of atoms in the compound, if not provided, it will be calculated from the structure **kwargs: Additional data - A use case is for the scenarios where the *data* parameter is provided, these arguments will be used to parse and clean the data """ # convert keys to lowercase lower_kwargs = {key.lower(): value for key, value in kwargs.items()} self.structure = _structure if _structure is not None else self.structure try: temp_structure = _get_molecule(structure, **lower_kwargs) self.structure = temp_structure if temp_structure is not None else self.structure except Exception: pass self.id = id if id is not None else self.id self.spectrum = _spectrum if _spectrum is not None else self.spectrum if spectrum is not None or "precursor_mz" in lower_kwargs: try: spectrum = convert.to_spectrum(spectrum, **lower_kwargs) except Exception as e: spectrum = None raise e if spectrum is not None and spectrum.mz is not None: self.spectrum = spectrum self.usi = usi if usi is not None else self.usi self.is_known = is_known if (is_known is not None) else self.is_known self.name = name if name is not None else self.name if self.name is None: self.name = lower_kwargs.get('compound_name', None) # update the rest of the attributes self.additional_attributes.update(additional_attributes) self._parse_data()
def _parse_data(self): """ Parse missing and verify the data of the class""" # if self.is_known is None: # self.is_known = (self.structure is not None) # if no id is provided, generate one if self.id is None: self.id = str(uuid.uuid4()) # TODO: check for a valid compound # what is needed for a compound: # id, spectrum.peaks, spectrum.precursor_mass, spectrum.charge, spectrum.adduct def __str__(self): valuable_data_keys = ['id', 'name', 'usi'] strings = [f"{key}: {self.__dict__[key]}" for key in valuable_data_keys if self.__dict__[key] is not None] joined = ', '.join(strings) result = f"Compound({joined}) with {len(self.spectrum.mz)} peaks" if self.structure is not None: result += f" and structure {Chem.MolToSmiles(self.structure)}" return result
[docs] def copy(self): """Return a copy of the compound""" copied_compound = Compound() convert.to_compound(self, use_object = copied_compound) return copied_compound
[docs] def get_meta_data(self): """ Get the meta data of the compound Returns: dict: A dictionary containing the meta data of the compound """ description = { "num_peaks": len(self.spectrum.mz), "adduct": self.spectrum.adduct, "precursor_mz": self.spectrum.precursor_mz, "charge": self.spectrum.precursor_charge, } if self.name is not None: description["name"] = self.name if self.is_known: st_meta = StructureMeta.from_structure(self.structure) description.update(st_meta.__dict__) return description
[docs] def print_peaks_to_fragments_map(self, peaks: list = None): """Print the peaks to fragments map Parameters ---------- peaks : list, optional (default: None) The list of peaks to print the fragments for, if None, print all peaks """ if peaks is None: peaks = range(len(self.spectrum.mz)) for peak in peaks: print(f"Peak {peak}: {self.spectrum.mz[peak]}, Fragments: {self.spectrum.peak_fragments_map[peak]}") print()
[docs] def find_existance(self, peakids: list): """ For each atom, and for each peak in the list, find the fragments that the atom is part of Parameters ---------- peakids : list of peak ids Returns ------- existance : list of dicts for each atom, each dict contains the peak ids as keys and the fragments as values """ existance = [dict() for i in range(len(self.structure.GetAtoms()))] for peak in peakids: for fragment in self.spectrum.peak_fragments_map[peak]: # get all the bits that are 1 in the fragment bin_fragment = bin(fragment) len_fragment = len(bin_fragment) hitAtoms = [len_fragment-i-1 for i in range(len(bin_fragment)) if bin_fragment[i] == '1'] for atom in hitAtoms: if peak not in existance[atom]: existance[atom][peak] = [] existance[atom][peak].append(fragment) return existance
[docs] def calculate_contribution_atom_in_peak(self, atom: int, peakindx:int, existance_data:list, CI:bool = False, CPA:bool = True, CFA:bool = True): """Calculates the contribution of an atom to a peak Parameters ---------- atom : int The index of the atom peakindx : int The index of the peak existance_data : list of dicts The existance data for the atoms CI : bool, optional (default: False) Calculate the intensity factor CPA : bool, optional (default: True) Calculate the atom peak ambiguity factor CFA : bool, optional (default: True) Calculate the fragment ambiguity factor """ contribution = 0 if peakindx not in existance_data[atom]: return contribution intensity_factor = 1 atom_peak_ambiguity_factor = 1 fragment_ambiguity_factor = 1 if CI: intensity_factor = self.spectrum.intensity[peakindx] if CPA: atom_peak_ambiguity_factor = 1/len(self.spectrum.peak_fragments_map[peakindx]) for frag in existance_data[atom][peakindx]: if CFA: fragment_ambiguity_factor = 1/(bin(frag).count("1")) contribution += intensity_factor * atom_peak_ambiguity_factor * fragment_ambiguity_factor return contribution
[docs] def calculate_contributions(self, peakids, CI = False, CPA = True, CFA = True, CPE = True): """ input: peakids: list of peak ids CI: (Consider_Intensity) bool, if True, the intensity of the peaks is considered (default: False) CPA: (Consider_Peak_Ambiguity) bool, if True, the peak ambiguity (number of fragments assigned to a peak) is considered (default: True) CFA: (Consider_Fragment_Ambiguity) bool, if True, the fragment ambiguity (number of atoms in fragment) is considered (default: True) CPA: (Consider_Peak_Entropy) bool, if True, the peak entropy (how ambiguis the fragments are) is considered (default: True """ num_atoms = len(self.structure.GetAtoms()) existance_data = self.find_existance(peakids) contributions = [0 for i in range(num_atoms)] peak_atom_contributions = np.zeros((len(peakids), num_atoms)) for i, peak in enumerate(peakids): for atom in range(num_atoms): peak_atom_contributions[i][atom] = self.calculate_contribution_atom_in_peak(atom, peak, existance_data, CI=CI, CPA=CPA, CFA=CFA) if CPE: peak_entropies = np.zeros(len(peakids)) for i in range(len(peakids)): peak_entropies[i] = 1 - general_utils.entropy(peak_atom_contributions[i]) # peak_entropies = peak_entropies / np.max(peak_entropies) else: peak_entropies = np.ones(len(peakids)) for i in range(num_atoms): for j in range(len(peakids)): contributions[i] += peak_atom_contributions[j][i] * peak_entropies[j] return contributions
[docs] def filter_fragments_by_atoms(self, atoms: list, peaks: list = None): """Filter the fragments by the atoms, remove fragments that do not contain at least one of the atoms Parameters ---------- atoms: a list of atoms to filter the fragments peaks: a list of peaks to filter their fragments, if None, use all peaks Returns ------- updated: the number of updated peaks """ if peaks is None: peaks = [i for i in range(len(self.peaks))] updated = 0 for i in peaks: updated_fragments = set() for fragment in self.spectrum.peak_fragments_map[i]: for atom in atoms: if 1 << atom & fragment: updated_fragments.add(fragment) break if len(updated_fragments) != len(self.spectrum.peak_fragments_map[i]): updated += 1 self.spectrum.peak_fragments_map[i] = updated_fragments return updated
from typing import Tuple
[docs] def calculate_peak_annotation_ambiguity(self, peaks: list=None) -> Tuple[float, float]: """Calculate the peak annotation ambiguity Parameters ---------- peaks : list a list of peaks to calculate the ambiguity for, if None, use all peaks Returns ------- (float, float) : a tuple of two values (ambiguity, ratio) ambiguity: the average number of fragments per annotated peaks ratio: the ratio of annotated peaks to all peaks """ if peaks is None: peaks = [i for i in range(len(self.peaks))] ambiguity = 0 annotated_peaks = 0 for peak in peaks: if len(self.spectrum.peak_fragments_map[peak]) > 0: annotated_peaks += 1 ambiguity += len(self.spectrum.peak_fragments_map[peak]) if annotated_peaks == 0: return -1, 0 if len(peaks) == 0: return -1, -1 return ambiguity / annotated_peaks, annotated_peaks / len(peaks)
[docs] def calculate_annotation_entropy(self, peaks: list=None): """Calculate the entropy of the annotation Parameters ---------- peaks : list a list of peaks to calculate the entropy for, if None, use all peaks Returns ------- float : the entropy of the annotation """ if peaks is None: peaks = [i for i in range(len(self.peaks))] peak_entropies = [0 for i in range(len(self.peaks))] n = len(self.structure.GetAtoms()) for peak in peaks: atoms_appearance = [0 for i in range(n)] for fragment in self.spectrum.peak_fragments_map[peak]: for atom in range(n): if 1 << atom & fragment: atoms_appearance[atom] += 1 entropy = 0 for atom in range(n): if atoms_appearance[atom] > 0: p = atoms_appearance[atom] / len(self.spectrum.peak_fragments_map[peak]) entropy -= p * math.log(p) peak_entropies[peak] = entropy if len(peak_entropies) == 0: return -1 entropy = sum(peak_entropies) / len(peak_entropies) return entropy